C23H27N5O4 — CID 136789197
3-[(2E)-2-[(4-butoxy-3-ethoxyphenyl)methylidene]hydrazinyl]-6-(4-methoxyphenyl)-4H-1,2,4-triazin-5-one (PubChem CID 136789197) has the molecular formula C23H27N5O4 and a molecular weight of 437.50 g/mol. Its IUPAC name is 3-[(2E)-2-[(4-butoxy-3-ethoxyphenyl)methylidene]hydrazinyl]-6-(4-methoxyphenyl)-4H-1,2,4-triazin-5-one.
| Compound Name | 3-[(2E)-2-[(4-butoxy-3-ethoxyphenyl)methylidene]hydrazinyl]-6-(4-methoxyphenyl)-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 136789197 |
| Molecular Formula | C23H27N5O4 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 3-[(2E)-2-[(4-butoxy-3-ethoxyphenyl)methylidene]hydrazinyl]-6-(4-methoxyphenyl)-4H-1,2,4-triazin-5-one |
| SMILES | CCCCOc1ccc(/C=N/Nc2nnc(-c3ccc(OC)cc3)c(=O)[nH]2)cc1OCC |
| InChI | InChI=1S/C23H27N5O4/c1-4-6-13-32-19-12-7-16(14-20(19)31-5-2)15-24-27-23-25-22(29)21(26-28-23)17-8-10-18(30-3)11-9-17/h7-12,14-15H,4-6,13H2,1-3H3,(H2,25,27,28,29)/b24-15+ |
| InChIKey | FEJKAGNSXALSRU-BUVRLJJBSA-N |
| XLogP | 3.86 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|