About 3-(1H-imidazol-2-yl)-5-iodo-1,2,4-thiadiazole
3-(1H-imidazol-2-yl)-5-iodo-1,2,4-thiadiazole (PubChem CID 136789594) has the molecular formula C5H3IN4S
and a molecular weight of 278.08 g/mol. Its IUPAC name is 3-(1H-imidazol-2-yl)-5-iodo-1,2,4-thiadiazole.
Molecular Properties
| Compound Name | 3-(1H-imidazol-2-yl)-5-iodo-1,2,4-thiadiazole |
| PubChem CID | 136789594 |
| Molecular Formula | C5H3IN4S |
| Molecular Weight | 278.08 g/mol |
| Exact Mass | 277.91 |
| IUPAC Name | 3-(1H-imidazol-2-yl)-5-iodo-1,2,4-thiadiazole |
| SMILES | Ic1nc(-c2ncc[nH]2)ns1 |
| InChI | InChI=1S/C5H3IN4S/c6-5-9-4(10-11-5)3-7-1-2-8-3/h1-2H,(H,7,8) |
| InChIKey | SILJDHJAIZEAHC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.08 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-(1H-imidazol-2-yl)-5-iodo-1,2,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1H-imidazol-2-yl)-5-iodo-1,2,4-thiadiazole?
The IUPAC name of 3-(1H-imidazol-2-yl)-5-iodo-1,2,4-thiadiazole (CID 136789594) is 3-(1H-imidazol-2-yl)-5-iodo-1,2,4-thiadiazole.
What is the SMILES notation for 3-(1H-imidazol-2-yl)-5-iodo-1,2,4-thiadiazole?
The canonical SMILES for 3-(1H-imidazol-2-yl)-5-iodo-1,2,4-thiadiazole is Ic1nc(-c2ncc[nH]2)ns1.
What is the InChIKey of 3-(1H-imidazol-2-yl)-5-iodo-1,2,4-thiadiazole?
The InChIKey is SILJDHJAIZEAHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3IN4S/c6-5-9-4(10-11-5)3-7-1-2-8-3/h1-2H,(H,7,8).
What are the key properties of 3-(1H-imidazol-2-yl)-5-iodo-1,2,4-thiadiazole?
3-(1H-imidazol-2-yl)-5-iodo-1,2,4-thiadiazole has a molecular weight of 278.08 g/mol, XLogP of 1.53, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1H-imidazol-2-yl)-5-iodo-1,2,4-thiadiazole is sourced from PubChem (CID 136789594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).