About benzenesulfinylbenzene
benzenesulfinylbenzene (PubChem CID 13679) has the molecular formula C12H10OS
and a molecular weight of 202.28 g/mol. Its IUPAC name is benzenesulfinylbenzene.
Molecular Properties
| Compound Name | benzenesulfinylbenzene |
| PubChem CID | 13679 |
| Molecular Formula | C12H10OS |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | benzenesulfinylbenzene |
| SMILES | O=S(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C12H10OS/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| InChIKey | JJHHIJFTHRNPIK-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze benzenesulfinylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenesulfinylbenzene?
The IUPAC name of benzenesulfinylbenzene (CID 13679) is benzenesulfinylbenzene.
What is the SMILES notation for benzenesulfinylbenzene?
The canonical SMILES for benzenesulfinylbenzene is O=S(c1ccccc1)c1ccccc1.
What is the InChIKey of benzenesulfinylbenzene?
The InChIKey is JJHHIJFTHRNPIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10OS/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H.
What are the key properties of benzenesulfinylbenzene?
benzenesulfinylbenzene has a molecular weight of 202.28 g/mol, XLogP of 2.85, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzenesulfinylbenzene is sourced from PubChem (CID 13679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).