C31H27NO — CID 136790278
4-methyl-2-(6-naphthalen-1-yl-2-pyridinyl)-6-(2-phenylpropan-2-yl)phenol (PubChem CID 136790278) has the molecular formula C31H27NO and a molecular weight of 429.56 g/mol. Its IUPAC name is 4-methyl-2-(6-naphthalen-1-yl-2-pyridinyl)-6-(2-phenylpropan-2-yl)phenol.
| Compound Name | 4-methyl-2-(6-naphthalen-1-yl-2-pyridinyl)-6-(2-phenylpropan-2-yl)phenol |
|---|---|
| PubChem CID | 136790278 |
| Molecular Formula | C31H27NO |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 4-methyl-2-(6-naphthalen-1-yl-2-pyridinyl)-6-(2-phenylpropan-2-yl)phenol |
| SMILES | Cc1cc(-c2cccc(-c3cccc4ccccc34)n2)c(O)c(C(C)(C)c2ccccc2)c1 |
| InChI | InChI=1S/C31H27NO/c1-21-19-26(30(33)27(20-21)31(2,3)23-13-5-4-6-14-23)29-18-10-17-28(32-29)25-16-9-12-22-11-7-8-15-24(22)25/h4-20,33H,1-3H3 |
| InChIKey | JXZOSLVYCQMUSJ-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |