C11H13N5O2 — CID 136790373
4-(2-aminoethyl)-2-(6-methoxypyridazin-3-yl)-1H-pyrimidin-6-one (PubChem CID 136790373) has the molecular formula C11H13N5O2 and a molecular weight of 247.26 g/mol. Its IUPAC name is 4-(2-aminoethyl)-2-(6-methoxypyridazin-3-yl)-1H-pyrimidin-6-one.
| Compound Name | 4-(2-aminoethyl)-2-(6-methoxypyridazin-3-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136790373 |
| Molecular Formula | C11H13N5O2 |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 4-(2-aminoethyl)-2-(6-methoxypyridazin-3-yl)-1H-pyrimidin-6-one |
| SMILES | COc1ccc(-c2nc(CCN)cc(=O)[nH]2)nn1 |
| InChI | InChI=1S/C11H13N5O2/c1-18-10-3-2-8(15-16-10)11-13-7(4-5-12)6-9(17)14-11/h2-3,6H,4-5,12H2,1H3,(H,13,14,17) |
| InChIKey | ONIPCUIJKJWKDA-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 106.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |