About 5-chloro-4-[(3,3-difluoro-2-hydroxypropyl)amino]-1H-pyrimidin-6-one
5-chloro-4-[(3,3-difluoro-2-hydroxypropyl)amino]-1H-pyrimidin-6-one (PubChem CID 136790784) has the molecular formula C7H8ClF2N3O2
and a molecular weight of 239.61 g/mol. Its IUPAC name is 5-chloro-4-[(3,3-difluoro-2-hydroxypropyl)amino]-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 5-chloro-4-[(3,3-difluoro-2-hydroxypropyl)amino]-1H-pyrimidin-6-one |
| PubChem CID | 136790784 |
| Molecular Formula | C7H8ClF2N3O2 |
| Molecular Weight | 239.61 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 5-chloro-4-[(3,3-difluoro-2-hydroxypropyl)amino]-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(NCC(O)C(F)F)c1Cl |
| InChI | InChI=1S/C7H8ClF2N3O2/c8-4-6(12-2-13-7(4)15)11-1-3(14)5(9)10/h2-3,5,14H,1H2,(H2,11,12,13,15) |
| InChIKey | CMDLHCSAYWITHB-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.61 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-4-[(3,3-difluoro-2-hydroxypropyl)amino]-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-4-[(3,3-difluoro-2-hydroxypropyl)amino]-1H-pyrimidin-6-one?
The IUPAC name of 5-chloro-4-[(3,3-difluoro-2-hydroxypropyl)amino]-1H-pyrimidin-6-one (CID 136790784) is 5-chloro-4-[(3,3-difluoro-2-hydroxypropyl)amino]-1H-pyrimidin-6-one.
What is the SMILES notation for 5-chloro-4-[(3,3-difluoro-2-hydroxypropyl)amino]-1H-pyrimidin-6-one?
The canonical SMILES for 5-chloro-4-[(3,3-difluoro-2-hydroxypropyl)amino]-1H-pyrimidin-6-one is O=c1[nH]cnc(NCC(O)C(F)F)c1Cl.
What is the InChIKey of 5-chloro-4-[(3,3-difluoro-2-hydroxypropyl)amino]-1H-pyrimidin-6-one?
The InChIKey is CMDLHCSAYWITHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8ClF2N3O2/c8-4-6(12-2-13-7(4)15)11-1-3(14)5(9)10/h2-3,5,14H,1H2,(H2,11,12,13,15).
What are the key properties of 5-chloro-4-[(3,3-difluoro-2-hydroxypropyl)amino]-1H-pyrimidin-6-one?
5-chloro-4-[(3,3-difluoro-2-hydroxypropyl)amino]-1H-pyrimidin-6-one has a molecular weight of 239.61 g/mol, XLogP of 0.46, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-4-[(3,3-difluoro-2-hydroxypropyl)amino]-1H-pyrimidin-6-one is sourced from PubChem (CID 136790784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).