C14H10F2N4S — CID 136790934
5-(2,5-difluorophenyl)-N-pyridin-2-yl-3,6-dihydro-1,3,4-thiadiazin-2-imine (PubChem CID 136790934) has the molecular formula C14H10F2N4S and a molecular weight of 304.32 g/mol. Its IUPAC name is 5-(2,5-difluorophenyl)-N-pyridin-2-yl-3,6-dihydro-1,3,4-thiadiazin-2-imine.
| Compound Name | 5-(2,5-difluorophenyl)-N-pyridin-2-yl-3,6-dihydro-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 136790934 |
| Molecular Formula | C14H10F2N4S |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 5-(2,5-difluorophenyl)-N-pyridin-2-yl-3,6-dihydro-1,3,4-thiadiazin-2-imine |
| SMILES | Fc1ccc(F)c(C2=NNC(=Nc3ccccn3)SC2)c1 |
| InChI | InChI=1S/C14H10F2N4S/c15-9-4-5-11(16)10(7-9)12-8-21-14(20-19-12)18-13-3-1-2-6-17-13/h1-7H,8H2,(H,17,18,20) |
| InChIKey | CIRMVGHNMZWUFG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_urea_L(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|