C24H20N2O5 — CID 136792343
2-[(5S,10bS)-5-(1,3-benzodioxol-5-yl)-7-methoxy-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-2-yl]phenol (PubChem CID 136792343) has the molecular formula C24H20N2O5 and a molecular weight of 416.43 g/mol. Its IUPAC name is 2-[(5S,10bS)-5-(1,3-benzodioxol-5-yl)-7-methoxy-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-2-yl]phenol.
| Compound Name | 2-[(5S,10bS)-5-(1,3-benzodioxol-5-yl)-7-methoxy-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-2-yl]phenol |
|---|---|
| PubChem CID | 136792343 |
| Molecular Formula | C24H20N2O5 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 2-[(5S,10bS)-5-(1,3-benzodioxol-5-yl)-7-methoxy-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-2-yl]phenol |
| SMILES | COc1cccc2c1O[C@@H](c1ccc3c(c1)OCO3)N1N=C(c3ccccc3O)C[C@@H]21 |
| InChI | InChI=1S/C24H20N2O5/c1-28-21-8-4-6-16-18-12-17(15-5-2-3-7-19(15)27)25-26(18)24(31-23(16)21)14-9-10-20-22(11-14)30-13-29-20/h2-11,18,24,27H,12-13H2,1H3/t18-,24-/m0/s1 |
| InChIKey | XBAYKEZMRSUJSL-UUOWRZLLSA-N |
| XLogP | 4.37 |
| TPSA | 72.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'} |
|---|