C23H19ClN2O4 — CID 136792682
(3S)-N-[(Z)-[5-[(2-chlorophenyl)methyl]-2-hydroxyphenyl]methylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide (PubChem CID 136792682) has the molecular formula C23H19ClN2O4 and a molecular weight of 422.87 g/mol. Its IUPAC name is (3S)-N-[(Z)-[5-[(2-chlorophenyl)methyl]-2-hydroxyphenyl]methylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide.
| Compound Name | (3S)-N-[(Z)-[5-[(2-chlorophenyl)methyl]-2-hydroxyphenyl]methylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
|---|---|
| PubChem CID | 136792682 |
| Molecular Formula | C23H19ClN2O4 |
| Molecular Weight | 422.87 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | (3S)-N-[(Z)-[5-[(2-chlorophenyl)methyl]-2-hydroxyphenyl]methylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| SMILES | O=C(N/N=C\c1cc(Cc2ccccc2Cl)ccc1O)[C@@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C23H19ClN2O4/c24-18-6-2-1-5-16(18)11-15-9-10-19(27)17(12-15)13-25-26-23(28)22-14-29-20-7-3-4-8-21(20)30-22/h1-10,12-13,22,27H,11,14H2,(H,26,28)/b25-13-/t22-/m0/s1 |
| InChIKey | QWEPTHKTNYYZLW-GHJVFANLSA-N |
| XLogP | 3.93 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.87 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|