C20H23ClF3N5O — CID 1367928
[(5S,7S)-3-chloro-5-(4-methylphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 1367928) has the molecular formula C20H23ClF3N5O and a molecular weight of 441.89 g/mol. Its IUPAC name is [(5S,7S)-3-chloro-5-(4-methylphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [(5S,7S)-3-chloro-5-(4-methylphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 1367928 |
| Molecular Formula | C20H23ClF3N5O |
| Molecular Weight | 441.89 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | [(5S,7S)-3-chloro-5-(4-methylphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | Cc1ccc([C@@H]2C[C@@H](C(F)(F)F)n3nc(C(=O)N4CCN(C)CC4)c(Cl)c3N2)cc1 |
| InChI | InChI=1S/C20H23ClF3N5O/c1-12-3-5-13(6-4-12)14-11-15(20(22,23)24)29-18(25-14)16(21)17(26-29)19(30)28-9-7-27(2)8-10-28/h3-6,14-15,25H,7-11H2,1-2H3/t14-,15-/m0/s1 |
| InChIKey | LHEKNYLVFFSNSD-GJZGRUSLSA-N |
| XLogP | 3.89 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.89 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |