C12H18ClN3O2 — CID 136792834
5-chloro-4-(2,2,6,6-tetramethylmorpholin-4-yl)-1H-pyrimidin-6-one (PubChem CID 136792834) has the molecular formula C12H18ClN3O2 and a molecular weight of 271.75 g/mol. Its IUPAC name is 5-chloro-4-(2,2,6,6-tetramethylmorpholin-4-yl)-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-(2,2,6,6-tetramethylmorpholin-4-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136792834 |
| Molecular Formula | C12H18ClN3O2 |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 5-chloro-4-(2,2,6,6-tetramethylmorpholin-4-yl)-1H-pyrimidin-6-one |
| SMILES | CC1(C)CN(c2nc[nH]c(=O)c2Cl)CC(C)(C)O1 |
| InChI | InChI=1S/C12H18ClN3O2/c1-11(2)5-16(6-12(3,4)18-11)9-8(13)10(17)15-7-14-9/h7H,5-6H2,1-4H3,(H,14,15,17) |
| InChIKey | YHANMIHMXPCCGR-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |