C18H22N4O3 — CID 136793208
2-(4-methyl-6-oxo-2-pyridin-3-yl-1H-pyrimidin-5-yl)-N-[[(3R)-oxan-3-yl]methyl]acetamide (PubChem CID 136793208) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is 2-(4-methyl-6-oxo-2-pyridin-3-yl-1H-pyrimidin-5-yl)-N-[[(3R)-oxan-3-yl]methyl]acetamide.
| Compound Name | 2-(4-methyl-6-oxo-2-pyridin-3-yl-1H-pyrimidin-5-yl)-N-[[(3R)-oxan-3-yl]methyl]acetamide |
|---|---|
| PubChem CID | 136793208 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 2-(4-methyl-6-oxo-2-pyridin-3-yl-1H-pyrimidin-5-yl)-N-[[(3R)-oxan-3-yl]methyl]acetamide |
| SMILES | Cc1nc(-c2cccnc2)[nH]c(=O)c1CC(=O)NC[C@H]1CCCOC1 |
| InChI | InChI=1S/C18H22N4O3/c1-12-15(8-16(23)20-9-13-4-3-7-25-11-13)18(24)22-17(21-12)14-5-2-6-19-10-14/h2,5-6,10,13H,3-4,7-9,11H2,1H3,(H,20,23)(H,21,22,24)/t13-/m1/s1 |
| InChIKey | TZUOCNTWXLYKDB-CYBMUJFWSA-N |
| XLogP | 1.23 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |