C10H13IN4O2 — CID 136794218
1-(5-iodo-6-oxo-1H-pyrimidin-4-yl)-3-methylpyrrolidine-3-carboxamide (PubChem CID 136794218) has the molecular formula C10H13IN4O2 and a molecular weight of 348.14 g/mol. Its IUPAC name is 1-(5-iodo-6-oxo-1H-pyrimidin-4-yl)-3-methylpyrrolidine-3-carboxamide.
| Compound Name | 1-(5-iodo-6-oxo-1H-pyrimidin-4-yl)-3-methylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 136794218 |
| Molecular Formula | C10H13IN4O2 |
| Molecular Weight | 348.14 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | 1-(5-iodo-6-oxo-1H-pyrimidin-4-yl)-3-methylpyrrolidine-3-carboxamide |
| SMILES | CC1(C(N)=O)CCN(c2nc[nH]c(=O)c2I)C1 |
| InChI | InChI=1S/C10H13IN4O2/c1-10(9(12)17)2-3-15(4-10)7-6(11)8(16)14-5-13-7/h5H,2-4H2,1H3,(H2,12,17)(H,13,14,16) |
| InChIKey | XNQGTEDZTAUQTB-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.14 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|