C12H16N4O2 — CID 136794231
1-(2-cyclopropyl-6-oxo-1H-pyrimidin-4-yl)pyrrolidine-3-carboxamide (PubChem CID 136794231) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 1-(2-cyclopropyl-6-oxo-1H-pyrimidin-4-yl)pyrrolidine-3-carboxamide.
| Compound Name | 1-(2-cyclopropyl-6-oxo-1H-pyrimidin-4-yl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 136794231 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 1-(2-cyclopropyl-6-oxo-1H-pyrimidin-4-yl)pyrrolidine-3-carboxamide |
| SMILES | NC(=O)C1CCN(c2cc(=O)[nH]c(C3CC3)n2)C1 |
| InChI | InChI=1S/C12H16N4O2/c13-11(18)8-3-4-16(6-8)9-5-10(17)15-12(14-9)7-1-2-7/h5,7-8H,1-4,6H2,(H2,13,18)(H,14,15,17) |
| InChIKey | LKLWHQLMGQVLNM-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |