C10H14N4O3 — CID 136794232
1-(5-methoxy-6-oxo-1H-pyrimidin-4-yl)pyrrolidine-3-carboxamide (PubChem CID 136794232) has the molecular formula C10H14N4O3 and a molecular weight of 238.25 g/mol. Its IUPAC name is 1-(5-methoxy-6-oxo-1H-pyrimidin-4-yl)pyrrolidine-3-carboxamide.
| Compound Name | 1-(5-methoxy-6-oxo-1H-pyrimidin-4-yl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 136794232 |
| Molecular Formula | C10H14N4O3 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 1-(5-methoxy-6-oxo-1H-pyrimidin-4-yl)pyrrolidine-3-carboxamide |
| SMILES | COc1c(N2CCC(C(N)=O)C2)nc[nH]c1=O |
| InChI | InChI=1S/C10H14N4O3/c1-17-7-9(12-5-13-10(7)16)14-3-2-6(4-14)8(11)15/h5-6H,2-4H2,1H3,(H2,11,15)(H,12,13,16) |
| InChIKey | XBXOVKBSPODFFP-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |