C10H9F6N3O2 — CID 136794793
2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N'-hydroxy-6-methylpyridine-4-carboximidamide (PubChem CID 136794793) has the molecular formula C10H9F6N3O2 and a molecular weight of 317.19 g/mol. Its IUPAC name is 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N'-hydroxy-6-methylpyridine-4-carboximidamide.
| Compound Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N'-hydroxy-6-methylpyridine-4-carboximidamide |
|---|---|
| PubChem CID | 136794793 |
| Molecular Formula | C10H9F6N3O2 |
| Molecular Weight | 317.19 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N'-hydroxy-6-methylpyridine-4-carboximidamide |
| SMILES | Cc1cc(/C(N)=N/O)cc(OC(C(F)(F)F)C(F)(F)F)n1 |
| InChI | InChI=1S/C10H9F6N3O2/c1-4-2-5(7(17)19-20)3-6(18-4)21-8(9(11,12)13)10(14,15)16/h2-3,8,20H,1H3,(H2,17,19) |
| InChIKey | CTEMISSXQSGCGP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.19 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|