C20H24F2N4O3S — CID 136796862
2-[1-(3,4-difluorophenyl)sulfonylpyrrolidin-2-yl]-7-propan-2-yl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 136796862) has the molecular formula C20H24F2N4O3S and a molecular weight of 438.50 g/mol. Its IUPAC name is 2-[1-(3,4-difluorophenyl)sulfonylpyrrolidin-2-yl]-7-propan-2-yl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 2-[1-(3,4-difluorophenyl)sulfonylpyrrolidin-2-yl]-7-propan-2-yl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136796862 |
| Molecular Formula | C20H24F2N4O3S |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 2-[1-(3,4-difluorophenyl)sulfonylpyrrolidin-2-yl]-7-propan-2-yl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | CC(C)N1CCc2c(nc(C3CCCN3S(=O)(=O)c3ccc(F)c(F)c3)[nH]c2=O)C1 |
| InChI | InChI=1S/C20H24F2N4O3S/c1-12(2)25-9-7-14-17(11-25)23-19(24-20(14)27)18-4-3-8-26(18)30(28,29)13-5-6-15(21)16(22)10-13/h5-6,10,12,18H,3-4,7-9,11H2,1-2H3,(H,23,24,27) |
| InChIKey | XMHAIBGUFZOSGF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |