C11H9F3N2OS2 — CID 136797652
2-(2-thiophen-2-ylethylsulfanyl)-4-(trifluoromethyl)-1H-pyrimidin-6-one (PubChem CID 136797652) has the molecular formula C11H9F3N2OS2 and a molecular weight of 306.33 g/mol. Its IUPAC name is 2-(2-thiophen-2-ylethylsulfanyl)-4-(trifluoromethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-(2-thiophen-2-ylethylsulfanyl)-4-(trifluoromethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136797652 |
| Molecular Formula | C11H9F3N2OS2 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | 2-(2-thiophen-2-ylethylsulfanyl)-4-(trifluoromethyl)-1H-pyrimidin-6-one |
| SMILES | O=c1cc(C(F)(F)F)nc(SCCc2cccs2)[nH]1 |
| InChI | InChI=1S/C11H9F3N2OS2/c12-11(13,14)8-6-9(17)16-10(15-8)19-5-3-7-2-1-4-18-7/h1-2,4,6H,3,5H2,(H,15,16,17) |
| InChIKey | JGFIQJLXFDRKMR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |