C19H21N5O5 — CID 136798247
cyclohexyl (7R)-5-methyl-7-(3-nitrooxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 136798247) has the molecular formula C19H21N5O5 and a molecular weight of 399.41 g/mol. Its IUPAC name is cyclohexyl (7R)-5-methyl-7-(3-nitrooxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | cyclohexyl (7R)-5-methyl-7-(3-nitrooxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 136798247 |
| Molecular Formula | C19H21N5O5 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | cyclohexyl (7R)-5-methyl-7-(3-nitrooxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CC1=C(C(=O)OC2CCCCC2)[C@@H](c2cccc(O[N+](=O)[O-])c2)n2ncnc2N1 |
| InChI | InChI=1S/C19H21N5O5/c1-12-16(18(25)28-14-7-3-2-4-8-14)17(23-19(22-12)20-11-21-23)13-6-5-9-15(10-13)29-24(26)27/h5-6,9-11,14,17H,2-4,7-8H2,1H3,(H,20,21,22)/t17-/m1/s1 |
| InChIKey | ZOIULZOYQXWUPO-QGZVFWFLSA-N |
| XLogP | 3.01 |
| TPSA | 121.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|