About CID 136798587
CID 136798587 (PubChem CID 136798587) has the molecular formula C29H59OSi3
and a molecular weight of 508.05 g/mol.
Molecular Properties
| Compound Name | CID 136798587 |
| PubChem CID | 136798587 |
| Molecular Formula | C29H59OSi3 |
| Molecular Weight | 508.05 g/mol |
| Exact Mass | 507.39 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Si](C)(C([Si](O)[Si](C)(C(C)(C)C)C(C)(C)C)C12CC3CC(CC(C3)C1)C2)C(C)(C)C |
| InChI | InChI=1S/C29H59OSi3/c1-25(2,3)32(13,26(4,5)6)24(31(30)33(14,27(7,8)9)28(10,11)12)29-18-21-15-22(19-29)17-23(16-21)20-29/h21-24,30H,15-20H2,1-14H3 |
| InChIKey | YJCUKCTZHBYLMW-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 508.05 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 136798587 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 136798587?
The IUPAC name of CID 136798587 (CID 136798587) is not available.
What is the SMILES notation for CID 136798587?
The canonical SMILES for CID 136798587 is CC(C)(C)[Si](C)(C([Si](O)[Si](C)(C(C)(C)C)C(C)(C)C)C12CC3CC(CC(C3)C1)C2)C(C)(C)C.
What is the InChIKey of CID 136798587?
The InChIKey is YJCUKCTZHBYLMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H59OSi3/c1-25(2,3)32(13,26(4,5)6)24(31(30)33(14,27(7,8)9)28(10,11)12)29-18-21-15-22(19-29)17-23(16-21)20-29/h21-24,30H,15-20H2,1-14H3.
What are the key properties of CID 136798587?
CID 136798587 has a molecular weight of 508.05 g/mol, XLogP of 9.53, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 136798587 is sourced from PubChem (CID 136798587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).