C21H22N2O — CID 136798597
2-[(3,8-dimethyl-5-propan-2-ylazulen-1-yl)diazenyl]phenol (PubChem CID 136798597) has the molecular formula C21H22N2O and a molecular weight of 318.42 g/mol. Its IUPAC name is 2-[(3,8-dimethyl-5-propan-2-ylazulen-1-yl)diazenyl]phenol.
| Compound Name | 2-[(3,8-dimethyl-5-propan-2-ylazulen-1-yl)diazenyl]phenol |
|---|---|
| PubChem CID | 136798597 |
| Molecular Formula | C21H22N2O |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 2-[(3,8-dimethyl-5-propan-2-ylazulen-1-yl)diazenyl]phenol |
| SMILES | Cc1cc(/N=N/c2ccccc2O)c2c(C)ccc(C(C)C)cc1-2 |
| InChI | InChI=1S/C21H22N2O/c1-13(2)16-10-9-14(3)21-17(12-16)15(4)11-19(21)23-22-18-7-5-6-8-20(18)24/h5-13,24H,1-4H3/b23-22+ |
| InChIKey | UMYSPZZXTNUCBV-GHVJWSGMSA-N |
| XLogP | 6.65 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|