About 2-[(3,8-dimethyl-5-propan-2-ylazulen-1-yl)diazenyl]phenol
2-[(3,8-dimethyl-5-propan-2-ylazulen-1-yl)diazenyl]phenol (PubChem CID 136798597) has the molecular formula C21H22N2O
and a molecular weight of 318.42 g/mol. Its IUPAC name is 2-[(3,8-dimethyl-5-propan-2-ylazulen-1-yl)diazenyl]phenol.
Molecular Properties
| Compound Name | 2-[(3,8-dimethyl-5-propan-2-ylazulen-1-yl)diazenyl]phenol |
| PubChem CID | 136798597 |
| Molecular Formula | C21H22N2O |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 2-[(3,8-dimethyl-5-propan-2-ylazulen-1-yl)diazenyl]phenol |
| SMILES | Cc1cc(/N=N/c2ccccc2O)c2c(C)ccc(C(C)C)cc1-2 |
| InChI | InChI=1S/C21H22N2O/c1-13(2)16-10-9-14(3)21-17(12-16)15(4)11-19(21)23-22-18-7-5-6-8-20(18)24/h5-13,24H,1-4H3/b23-22+ |
| InChIKey | UMYSPZZXTNUCBV-GHVJWSGMSA-N |
| XLogP | 6.65 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3,8-dimethyl-5-propan-2-ylazulen-1-yl)diazenyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,8-dimethyl-5-propan-2-ylazulen-1-yl)diazenyl]phenol?
The IUPAC name of 2-[(3,8-dimethyl-5-propan-2-ylazulen-1-yl)diazenyl]phenol (CID 136798597) is 2-[(3,8-dimethyl-5-propan-2-ylazulen-1-yl)diazenyl]phenol.
What is the SMILES notation for 2-[(3,8-dimethyl-5-propan-2-ylazulen-1-yl)diazenyl]phenol?
The canonical SMILES for 2-[(3,8-dimethyl-5-propan-2-ylazulen-1-yl)diazenyl]phenol is Cc1cc(/N=N/c2ccccc2O)c2c(C)ccc(C(C)C)cc1-2.
What is the InChIKey of 2-[(3,8-dimethyl-5-propan-2-ylazulen-1-yl)diazenyl]phenol?
The InChIKey is UMYSPZZXTNUCBV-GHVJWSGMSA-N. The full InChI is InChI=1S/C21H22N2O/c1-13(2)16-10-9-14(3)21-17(12-16)15(4)11-19(21)23-22-18-7-5-6-8-20(18)24/h5-13,24H,1-4H3/b23-22+.
What are the key properties of 2-[(3,8-dimethyl-5-propan-2-ylazulen-1-yl)diazenyl]phenol?
2-[(3,8-dimethyl-5-propan-2-ylazulen-1-yl)diazenyl]phenol has a molecular weight of 318.42 g/mol, XLogP of 6.65, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,8-dimethyl-5-propan-2-ylazulen-1-yl)diazenyl]phenol is sourced from PubChem (CID 136798597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).