C41H44N2O2 — CID 136799540
6-[[(1R,2R)-2-[1-(6-hydroxy-5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)ethylideneamino]cyclohexyl]iminomethyl]tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaen-5-ol (PubChem CID 136799540) has the molecular formula C41H44N2O2 and a molecular weight of 596.82 g/mol. Its IUPAC name is 6-[[(1R,2R)-2-[1-(6-hydroxy-5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)ethylideneamino]cyclohexyl]iminomethyl]tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaen-5-ol.
| Compound Name | 6-[[(1R,2R)-2-[1-(6-hydroxy-5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)ethylideneamino]cyclohexyl]iminomethyl]tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaen-5-ol |
|---|---|
| PubChem CID | 136799540 |
| Molecular Formula | C41H44N2O2 |
| Molecular Weight | 596.82 g/mol |
| Exact Mass | 596.34 |
| IUPAC Name | 6-[[(1R,2R)-2-[1-(6-hydroxy-5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)ethylideneamino]cyclohexyl]iminomethyl]tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaen-5-ol |
| SMILES | C/C(=N\[C@@H]1CCCC[C@H]1/N=C/c1c2ccc(c1O)CCc1ccc(cc1)CC2)c1c2ccc(c1O)CCc1ccc(cc1)CC2 |
| InChI | InChI=1S/C41H44N2O2/c1-27(39-33-19-15-29-8-12-31(13-9-29)17-21-35(25-23-33)41(39)45)43-38-5-3-2-4-37(38)42-26-36-32-18-14-28-6-10-30(11-7-28)16-20-34(24-22-32)40(36)44/h6-13,22-26,37-38,44-45H,2-5,14-21H2,1H3/b42-26+,43-27+/t37-,38-/m1/s1 |
| InChIKey | VQIKNSWPKUFUKC-GMZZSGJTSA-N |
| XLogP | 8.10 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.82 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|