C20H13BrClF6N5O — CID 136799926
(5S,7R)-3-bromo-N-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-5-phenyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 136799926) has the molecular formula C20H13BrClF6N5O and a molecular weight of 568.70 g/mol. Its IUPAC name is (5S,7R)-3-bromo-N-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-5-phenyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | (5S,7R)-3-bromo-N-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-5-phenyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 136799926 |
| Molecular Formula | C20H13BrClF6N5O |
| Molecular Weight | 568.70 g/mol |
| Exact Mass | 566.99 |
| IUPAC Name | (5S,7R)-3-bromo-N-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-5-phenyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | O=C(Nc1ncc(C(F)(F)F)cc1Cl)c1nn2c(c1Br)N[C@H](c1ccccc1)C[C@@H]2C(F)(F)F |
| InChI | InChI=1S/C20H13BrClF6N5O/c21-14-15(18(34)31-16-11(22)6-10(8-29-16)19(23,24)25)32-33-13(20(26,27)28)7-12(30-17(14)33)9-4-2-1-3-5-9/h1-6,8,12-13,30H,7H2,(H,29,31,34)/t12-,13+/m0/s1 |
| InChIKey | XZAUVCCBZWPWPU-QWHCGFSZSA-N |
| XLogP | 6.63 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.70 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |