C20H17Br2F3N4O3 — CID 136799942
(5R,7R)-3-bromo-5-(5-bromofuran-2-yl)-N-[(4-methoxyphenyl)methyl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 136799942) has the molecular formula C20H17Br2F3N4O3 and a molecular weight of 578.18 g/mol. Its IUPAC name is (5R,7R)-3-bromo-5-(5-bromofuran-2-yl)-N-[(4-methoxyphenyl)methyl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | (5R,7R)-3-bromo-5-(5-bromofuran-2-yl)-N-[(4-methoxyphenyl)methyl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 136799942 |
| Molecular Formula | C20H17Br2F3N4O3 |
| Molecular Weight | 578.18 g/mol |
| Exact Mass | 575.96 |
| IUPAC Name | (5R,7R)-3-bromo-5-(5-bromofuran-2-yl)-N-[(4-methoxyphenyl)methyl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | COc1ccc(CNC(=O)c2nn3c(c2Br)N[C@@H](c2ccc(Br)o2)C[C@@H]3C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H17Br2F3N4O3/c1-31-11-4-2-10(3-5-11)9-26-19(30)17-16(22)18-27-12(13-6-7-15(21)32-13)8-14(20(23,24)25)29(18)28-17/h2-7,12,14,27H,8-9H2,1H3,(H,26,30)/t12-,14-/m1/s1 |
| InChIKey | UGXUPJYHXZQLGN-TZMCWYRMSA-N |
| XLogP | 5.60 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.18 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |