C17H16F3N3O3S — CID 136800421
(4R)-1-[(3R)-1,1-dioxothiolan-3-yl]-3-methyl-4-(2,3,4-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one (PubChem CID 136800421) has the molecular formula C17H16F3N3O3S and a molecular weight of 399.39 g/mol. Its IUPAC name is (4R)-1-[(3R)-1,1-dioxothiolan-3-yl]-3-methyl-4-(2,3,4-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one.
| Compound Name | (4R)-1-[(3R)-1,1-dioxothiolan-3-yl]-3-methyl-4-(2,3,4-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one |
|---|---|
| PubChem CID | 136800421 |
| Molecular Formula | C17H16F3N3O3S |
| Molecular Weight | 399.39 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | (4R)-1-[(3R)-1,1-dioxothiolan-3-yl]-3-methyl-4-(2,3,4-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one |
| SMILES | Cc1nn([C@@H]2CCS(=O)(=O)C2)c2c1[C@H](c1ccc(F)c(F)c1F)CC(=O)N2 |
| InChI | InChI=1S/C17H16F3N3O3S/c1-8-14-11(10-2-3-12(18)16(20)15(10)19)6-13(24)21-17(14)23(22-8)9-4-5-27(25,26)7-9/h2-3,9,11H,4-7H2,1H3,(H,21,24)/t9-,11+/m1/s1 |
| InChIKey | BYPXJEFHPKRHND-KOLCDFICSA-N |
| XLogP | 2.44 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|