C20H24N2O2 — CID 136800587
2-[(3aS,7aS)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]-3-hydroxy-5-(3-methylphenyl)cyclohex-2-en-1-one (PubChem CID 136800587) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is 2-[(3aS,7aS)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]-3-hydroxy-5-(3-methylphenyl)cyclohex-2-en-1-one.
| Compound Name | 2-[(3aS,7aS)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]-3-hydroxy-5-(3-methylphenyl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 136800587 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 2-[(3aS,7aS)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]-3-hydroxy-5-(3-methylphenyl)cyclohex-2-en-1-one |
| SMILES | Cc1cccc(C2CC(=O)C(C3=N[C@H]4CCCC[C@@H]4N3)=C(O)C2)c1 |
| InChI | InChI=1S/C20H24N2O2/c1-12-5-4-6-13(9-12)14-10-17(23)19(18(24)11-14)20-21-15-7-2-3-8-16(15)22-20/h4-6,9,14-16,23H,2-3,7-8,10-11H2,1H3,(H,21,22)/t14?,15-,16-/m0/s1 |
| InChIKey | HPBMKKITDILPTJ-YVZMLIKISA-N |
| XLogP | 3.57 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |