C20H12N6 — CID 136801219
11-imino-15-pyridin-4-yl-8,10,14-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,12,14-heptaene-12-carbonitrile (PubChem CID 136801219) has the molecular formula C20H12N6 and a molecular weight of 336.36 g/mol. Its IUPAC name is 11-imino-15-pyridin-4-yl-8,10,14-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,12,14-heptaene-12-carbonitrile.
| Compound Name | 11-imino-15-pyridin-4-yl-8,10,14-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,12,14-heptaene-12-carbonitrile |
|---|---|
| PubChem CID | 136801219 |
| Molecular Formula | C20H12N6 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 11-imino-15-pyridin-4-yl-8,10,14-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,12,14-heptaene-12-carbonitrile |
| SMILES | [H]/N=C1\N=C2Nc3ccccc3C3=CC(c4ccncc4)=NC(=C1C#N)C32 |
| InChI | InChI=1S/C20H12N6/c21-10-14-18-17-13(9-16(24-18)11-5-7-23-8-6-11)12-3-1-2-4-15(12)25-20(17)26-19(14)22/h1-9,17H,(H2,22,25,26) |
| InChIKey | YAYFHUBWTMWMGK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 97.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|