C12H10N4O2 — CID 136801879
(5S)-8-(4-methylphenyl)-3,5-dihydropurine-2,6-dione (PubChem CID 136801879) has the molecular formula C12H10N4O2 and a molecular weight of 242.24 g/mol. Its IUPAC name is (5S)-8-(4-methylphenyl)-3,5-dihydropurine-2,6-dione.
| Compound Name | (5S)-8-(4-methylphenyl)-3,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 136801879 |
| Molecular Formula | C12H10N4O2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | (5S)-8-(4-methylphenyl)-3,5-dihydropurine-2,6-dione |
| SMILES | Cc1ccc(C2=N[C@@H]3C(=O)NC(=O)NC3=N2)cc1 |
| InChI | InChI=1S/C12H10N4O2/c1-6-2-4-7(5-3-6)9-13-8-10(14-9)15-12(18)16-11(8)17/h2-5,8H,1H3,(H2,13,14,15,16,17,18)/t8-/m0/s1 |
| InChIKey | LHJYHPUCUZUHSI-QMMMGPOBSA-N |
| XLogP | 0.36 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |