C36H52N2O4 — CID 136802701
2-tert-butyl-6-[[(1R,2R)-2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]-4-(oxiran-2-ylmethoxymethyl)phenol (PubChem CID 136802701) has the molecular formula C36H52N2O4 and a molecular weight of 576.82 g/mol. Its IUPAC name is 2-tert-butyl-6-[[(1R,2R)-2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]-4-(oxiran-2-ylmethoxymethyl)phenol.
| Compound Name | 2-tert-butyl-6-[[(1R,2R)-2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]-4-(oxiran-2-ylmethoxymethyl)phenol |
|---|---|
| PubChem CID | 136802701 |
| Molecular Formula | C36H52N2O4 |
| Molecular Weight | 576.82 g/mol |
| Exact Mass | 576.39 |
| IUPAC Name | 2-tert-butyl-6-[[(1R,2R)-2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]-4-(oxiran-2-ylmethoxymethyl)phenol |
| SMILES | CC(C)(C)c1cc(/C=N/[C@@H]2CCCC[C@H]2/N=C/c2cc(COCC3CO3)cc(C(C)(C)C)c2O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C36H52N2O4/c1-34(2,3)26-16-25(33(40)29(17-26)36(7,8)9)19-38-31-13-11-10-12-30(31)37-18-24-14-23(20-41-21-27-22-42-27)15-28(32(24)39)35(4,5)6/h14-19,27,30-31,39-40H,10-13,20-22H2,1-9H3/b37-18+,38-19+/t27?,30-,31-/m1/s1 |
| InChIKey | XZOIDSIKJWSTIG-NNHUJHEUSA-N |
| XLogP | 7.75 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.82 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|