About CID 136802731
CID 136802731 (PubChem CID 136802731) has the molecular formula C36H70Se2Si7
and a molecular weight of 857.48 g/mol.
Molecular Properties
| Compound Name | CID 136802731 |
| PubChem CID | 136802731 |
| Molecular Formula | C36H70Se2Si7 |
| Molecular Weight | 857.48 g/mol |
| Exact Mass | 858.22 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)c([Si]([Se])([Se])c2c(C([Si](C)(C)C)[Si](C)(C)C)cc(C([Si](C)(C)C)[Si](C)(C)C)cc2C([Si](C)(C)C)[Si](C)(C)C)c(C)c1 |
| InChI | InChI=1S/C36H70Se2Si7/c1-26-22-27(2)32(28(3)23-26)45(37,38)33-30(35(41(10,11)12)42(13,14)15)24-29(34(39(4,5)6)40(7,8)9)25-31(33)36(43(16,17)18)44(19,20)21/h22-25,34-36H,1-21H3 |
| InChIKey | SULYFJMNZZCFQD-UHFFFAOYSA-N |
| XLogP | 10.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 857.48 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 136802731 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 136802731?
The IUPAC name of CID 136802731 (CID 136802731) is not available.
What is the SMILES notation for CID 136802731?
The canonical SMILES for CID 136802731 is Cc1cc(C)c([Si]([Se])([Se])c2c(C([Si](C)(C)C)[Si](C)(C)C)cc(C([Si](C)(C)C)[Si](C)(C)C)cc2C([Si](C)(C)C)[Si](C)(C)C)c(C)c1.
What is the InChIKey of CID 136802731?
The InChIKey is SULYFJMNZZCFQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H70Se2Si7/c1-26-22-27(2)32(28(3)23-26)45(37,38)33-30(35(41(10,11)12)42(13,14)15)24-29(34(39(4,5)6)40(7,8)9)25-31(33)36(43(16,17)18)44(19,20)21/h22-25,34-36H,1-21H3.
What are the key properties of CID 136802731?
CID 136802731 has a molecular weight of 857.48 g/mol, XLogP of 10.02, 11 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 136802731 is sourced from PubChem (CID 136802731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).