About 4-[[(4-ethyl-1,3-thiazinan-2-ylidene)amino]methyl]-3H-1,3-thiazol-2-one
4-[[(4-ethyl-1,3-thiazinan-2-ylidene)amino]methyl]-3H-1,3-thiazol-2-one (PubChem CID 136803565) has the molecular formula C10H15N3OS2
and a molecular weight of 257.38 g/mol. Its IUPAC name is 4-[[(4-ethyl-1,3-thiazinan-2-ylidene)amino]methyl]-3H-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 4-[[(4-ethyl-1,3-thiazinan-2-ylidene)amino]methyl]-3H-1,3-thiazol-2-one |
| PubChem CID | 136803565 |
| Molecular Formula | C10H15N3OS2 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 4-[[(4-ethyl-1,3-thiazinan-2-ylidene)amino]methyl]-3H-1,3-thiazol-2-one |
| SMILES | CCC1CCS/C(=N\Cc2csc(=O)[nH]2)N1 |
| InChI | InChI=1S/C10H15N3OS2/c1-2-7-3-4-15-9(12-7)11-5-8-6-16-10(14)13-8/h6-7H,2-5H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | XTKSTKKFODQOBS-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[[(4-ethyl-1,3-thiazinan-2-ylidene)amino]methyl]-3H-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(4-ethyl-1,3-thiazinan-2-ylidene)amino]methyl]-3H-1,3-thiazol-2-one?
The IUPAC name of 4-[[(4-ethyl-1,3-thiazinan-2-ylidene)amino]methyl]-3H-1,3-thiazol-2-one (CID 136803565) is 4-[[(4-ethyl-1,3-thiazinan-2-ylidene)amino]methyl]-3H-1,3-thiazol-2-one.
What is the SMILES notation for 4-[[(4-ethyl-1,3-thiazinan-2-ylidene)amino]methyl]-3H-1,3-thiazol-2-one?
The canonical SMILES for 4-[[(4-ethyl-1,3-thiazinan-2-ylidene)amino]methyl]-3H-1,3-thiazol-2-one is CCC1CCS/C(=N\Cc2csc(=O)[nH]2)N1.
What is the InChIKey of 4-[[(4-ethyl-1,3-thiazinan-2-ylidene)amino]methyl]-3H-1,3-thiazol-2-one?
The InChIKey is XTKSTKKFODQOBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3OS2/c1-2-7-3-4-15-9(12-7)11-5-8-6-16-10(14)13-8/h6-7H,2-5H2,1H3,(H,11,12)(H,13,14).
What are the key properties of 4-[[(4-ethyl-1,3-thiazinan-2-ylidene)amino]methyl]-3H-1,3-thiazol-2-one?
4-[[(4-ethyl-1,3-thiazinan-2-ylidene)amino]methyl]-3H-1,3-thiazol-2-one has a molecular weight of 257.38 g/mol, XLogP of 1.80, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(4-ethyl-1,3-thiazinan-2-ylidene)amino]methyl]-3H-1,3-thiazol-2-one is sourced from PubChem (CID 136803565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).