C12H19N3OS2 — CID 136803566
4-[[(4-tert-butyl-1,3-thiazinan-2-ylidene)amino]methyl]-3H-1,3-thiazol-2-one (PubChem CID 136803566) has the molecular formula C12H19N3OS2 and a molecular weight of 285.44 g/mol. Its IUPAC name is 4-[[(4-tert-butyl-1,3-thiazinan-2-ylidene)amino]methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[[(4-tert-butyl-1,3-thiazinan-2-ylidene)amino]methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 136803566 |
| Molecular Formula | C12H19N3OS2 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 4-[[(4-tert-butyl-1,3-thiazinan-2-ylidene)amino]methyl]-3H-1,3-thiazol-2-one |
| SMILES | CC(C)(C)C1CCS/C(=N\Cc2csc(=O)[nH]2)N1 |
| InChI | InChI=1S/C12H19N3OS2/c1-12(2,3)9-4-5-17-10(15-9)13-6-8-7-18-11(16)14-8/h7,9H,4-6H2,1-3H3,(H,13,15)(H,14,16) |
| InChIKey | BQXMVVRKIZTAQA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|