About 4-[(3S)-1-[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]piperidin-3-yl]benzoic acid
4-[(3S)-1-[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]piperidin-3-yl]benzoic acid (PubChem CID 136804322) has the molecular formula C20H23N3O4
and a molecular weight of 369.42 g/mol. Its IUPAC name is 4-[(3S)-1-[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]piperidin-3-yl]benzoic acid.
Molecular Properties
| Compound Name | 4-[(3S)-1-[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]piperidin-3-yl]benzoic acid |
| PubChem CID | 136804322 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 4-[(3S)-1-[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]piperidin-3-yl]benzoic acid |
| SMILES | Cc1nc(C)c(CC(=O)N2CCC[C@@H](c3ccc(C(=O)O)cc3)C2)c(=O)[nH]1 |
| InChI | InChI=1S/C20H23N3O4/c1-12-17(19(25)22-13(2)21-12)10-18(24)23-9-3-4-16(11-23)14-5-7-15(8-6-14)20(26)27/h5-8,16H,3-4,9-11H2,1-2H3,(H,26,27)(H,21,22,25)/t16-/m1/s1 |
| InChIKey | TXQRKVPMXCYQHE-MRXNPFEDSA-N |
| XLogP | 2.03 |
| TPSA | 103.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(3S)-1-[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]piperidin-3-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3S)-1-[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]piperidin-3-yl]benzoic acid?
The IUPAC name of 4-[(3S)-1-[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]piperidin-3-yl]benzoic acid (CID 136804322) is 4-[(3S)-1-[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]piperidin-3-yl]benzoic acid.
What is the SMILES notation for 4-[(3S)-1-[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]piperidin-3-yl]benzoic acid?
The canonical SMILES for 4-[(3S)-1-[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]piperidin-3-yl]benzoic acid is Cc1nc(C)c(CC(=O)N2CCC[C@@H](c3ccc(C(=O)O)cc3)C2)c(=O)[nH]1.
What is the InChIKey of 4-[(3S)-1-[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]piperidin-3-yl]benzoic acid?
The InChIKey is TXQRKVPMXCYQHE-MRXNPFEDSA-N. The full InChI is InChI=1S/C20H23N3O4/c1-12-17(19(25)22-13(2)21-12)10-18(24)23-9-3-4-16(11-23)14-5-7-15(8-6-14)20(26)27/h5-8,16H,3-4,9-11H2,1-2H3,(H,26,27)(H,21,22,25)/t16-/m1/s1.
What are the key properties of 4-[(3S)-1-[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]piperidin-3-yl]benzoic acid?
4-[(3S)-1-[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]piperidin-3-yl]benzoic acid has a molecular weight of 369.42 g/mol, XLogP of 2.03, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3S)-1-[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]piperidin-3-yl]benzoic acid is sourced from PubChem (CID 136804322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).