C13H21IN4O — CID 136805300
5-iodo-4-[piperidin-2-ylmethyl(propan-2-yl)amino]-1H-pyrimidin-6-one (PubChem CID 136805300) has the molecular formula C13H21IN4O and a molecular weight of 376.24 g/mol. Its IUPAC name is 5-iodo-4-[piperidin-2-ylmethyl(propan-2-yl)amino]-1H-pyrimidin-6-one.
| Compound Name | 5-iodo-4-[piperidin-2-ylmethyl(propan-2-yl)amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136805300 |
| Molecular Formula | C13H21IN4O |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 5-iodo-4-[piperidin-2-ylmethyl(propan-2-yl)amino]-1H-pyrimidin-6-one |
| SMILES | CC(C)N(CC1CCCCN1)c1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C13H21IN4O/c1-9(2)18(7-10-5-3-4-6-15-10)12-11(14)13(19)17-8-16-12/h8-10,15H,3-7H2,1-2H3,(H,16,17,19) |
| InChIKey | DYLNGGWIKFGUKN-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|