C58H44N6O6 — CID 136805862
methyl 2-[1-[10,20-bis(2-aminophenyl)-15-[2-(2-methoxy-2-oxoethoxy)naphthalen-1-yl]-21,23-dihydroporphyrin-5-yl]naphthalen-2-yl]oxyacetate (PubChem CID 136805862) has the molecular formula C58H44N6O6 and a molecular weight of 921.03 g/mol. Its IUPAC name is methyl 2-[1-[10,20-bis(2-aminophenyl)-15-[2-(2-methoxy-2-oxoethoxy)naphthalen-1-yl]-21,23-dihydroporphyrin-5-yl]naphthalen-2-yl]oxyacetate.
| Compound Name | methyl 2-[1-[10,20-bis(2-aminophenyl)-15-[2-(2-methoxy-2-oxoethoxy)naphthalen-1-yl]-21,23-dihydroporphyrin-5-yl]naphthalen-2-yl]oxyacetate |
|---|---|
| PubChem CID | 136805862 |
| Molecular Formula | C58H44N6O6 |
| Molecular Weight | 921.03 g/mol |
| Exact Mass | 920.33 |
| IUPAC Name | methyl 2-[1-[10,20-bis(2-aminophenyl)-15-[2-(2-methoxy-2-oxoethoxy)naphthalen-1-yl]-21,23-dihydroporphyrin-5-yl]naphthalen-2-yl]oxyacetate |
| SMILES | COC(=O)COc1ccc2ccccc2c1-c1c2nc(c(-c3ccccc3N)c3ccc([nH]3)c(-c3c(OCC(=O)OC)ccc4ccccc34)c3nc(c(-c4ccccc4N)c4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C58H44N6O6/c1-67-51(65)31-69-49-29-19-33-11-3-5-13-35(33)55(49)57-45-25-21-41(61-45)53(37-15-7-9-17-39(37)59)43-23-27-47(63-43)58(56-36-14-6-4-12-34(36)20-30-50(56)70-32-52(66)68-2)48-28-24-44(64-48)54(42-22-26-46(57)62-42)38-16-8-10-18-40(38)60/h3-30,61,64H,31-32,59-60H2,1-2H3/b53-41-,53-43-,54-42-,54-44-,57-45+,57-46+,58-47+,58-48+ |
| InChIKey | ANRVTKZDXAOISM-UQWVXHCOSA-N |
| XLogP | 11.90 |
| TPSA | 180.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 921.03 |
| LogP ≤ 5 | 11.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|