C51H44N4O3 — CID 136805971
5,24,24-trimethoxy-2,7,12,17-tetrakis(4-methylphenyl)-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3,5,7,9,11(23),12,14,16,18(21),19-undecaene (PubChem CID 136805971) has the molecular formula C51H44N4O3 and a molecular weight of 760.94 g/mol. Its IUPAC name is 5,24,24-trimethoxy-2,7,12,17-tetrakis(4-methylphenyl)-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3,5,7,9,11(23),12,14,16,18(21),19-undecaene.
| Compound Name | 5,24,24-trimethoxy-2,7,12,17-tetrakis(4-methylphenyl)-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3,5,7,9,11(23),12,14,16,18(21),19-undecaene |
|---|---|
| PubChem CID | 136805971 |
| Molecular Formula | C51H44N4O3 |
| Molecular Weight | 760.94 g/mol |
| Exact Mass | 760.34 |
| IUPAC Name | 5,24,24-trimethoxy-2,7,12,17-tetrakis(4-methylphenyl)-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3,5,7,9,11(23),12,14,16,18(21),19-undecaene |
| SMILES | COC1=C2/C(c3ccc(C)cc3)=C3/C=CC(=N3)/C(c3ccc(C)cc3)=c3/cc/c([nH]3)=C(\c3ccc(C)cc3)C3=N/C(=C(/c4ccc(C)cc4)C(=N1)C2(OC)OC)C=C3 |
| InChI | InChI=1S/C51H44N4O3/c1-30-8-16-34(17-9-30)44-38-24-25-39(52-38)45(35-18-10-31(2)11-19-35)41-27-29-43(54-41)47(37-22-14-33(4)15-23-37)49-51(57-6,58-7)48(50(55-49)56-5)46(42-28-26-40(44)53-42)36-20-12-32(3)13-21-36/h8-29,52H,1-7H3/b44-38-,44-40-,45-39-,45-41-,46-42-,47-43-,48-46-,49-47+ |
| InChIKey | JAYYQGOAYZONKN-MPBOBGEJSA-N |
| XLogP | 8.81 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.94 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|