C16H23F2N4O5P — CID 136806208
9-[[(3R,4R)-4-(2-diethoxyphosphoryl-2,2-difluoroethyl)oxolan-3-yl]methyl]-1H-purin-6-one (PubChem CID 136806208) has the molecular formula C16H23F2N4O5P and a molecular weight of 420.35 g/mol. Its IUPAC name is 9-[[(3R,4R)-4-(2-diethoxyphosphoryl-2,2-difluoroethyl)oxolan-3-yl]methyl]-1H-purin-6-one.
| Compound Name | 9-[[(3R,4R)-4-(2-diethoxyphosphoryl-2,2-difluoroethyl)oxolan-3-yl]methyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 136806208 |
| Molecular Formula | C16H23F2N4O5P |
| Molecular Weight | 420.35 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 9-[[(3R,4R)-4-(2-diethoxyphosphoryl-2,2-difluoroethyl)oxolan-3-yl]methyl]-1H-purin-6-one |
| SMILES | CCOP(=O)(OCC)C(F)(F)C[C@H]1COC[C@H]1Cn1cnc2c(=O)[nH]cnc21 |
| InChI | InChI=1S/C16H23F2N4O5P/c1-3-26-28(24,27-4-2)16(17,18)5-11-7-25-8-12(11)6-22-10-21-13-14(22)19-9-20-15(13)23/h9-12H,3-8H2,1-2H3,(H,19,20,23)/t11-,12+/m0/s1 |
| InChIKey | CNIKIWXDRXMJEN-NWDGAFQWSA-N |
| XLogP | 2.63 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|