C23H23N3O2S — CID 136807443
(4S)-3-methyl-1-(4-methylphenyl)-4-(4-prop-2-enoxyphenyl)-4,8-dihydropyrazolo[5,4-e][1,4]thiazepin-7-one (PubChem CID 136807443) has the molecular formula C23H23N3O2S and a molecular weight of 405.52 g/mol. Its IUPAC name is (4S)-3-methyl-1-(4-methylphenyl)-4-(4-prop-2-enoxyphenyl)-4,8-dihydropyrazolo[5,4-e][1,4]thiazepin-7-one.
| Compound Name | (4S)-3-methyl-1-(4-methylphenyl)-4-(4-prop-2-enoxyphenyl)-4,8-dihydropyrazolo[5,4-e][1,4]thiazepin-7-one |
|---|---|
| PubChem CID | 136807443 |
| Molecular Formula | C23H23N3O2S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | (4S)-3-methyl-1-(4-methylphenyl)-4-(4-prop-2-enoxyphenyl)-4,8-dihydropyrazolo[5,4-e][1,4]thiazepin-7-one |
| SMILES | C=CCOc1ccc([C@@H]2SCC(=O)Nc3c2c(C)nn3-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H23N3O2S/c1-4-13-28-19-11-7-17(8-12-19)22-21-16(3)25-26(18-9-5-15(2)6-10-18)23(21)24-20(27)14-29-22/h4-12,22H,1,13-14H2,2-3H3,(H,24,27)/t22-/m0/s1 |
| InChIKey | MRYSPOULSXYYQS-QFIPXVFZSA-N |
| XLogP | 4.83 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|