C16H26N4O3 — CID 136808425
2-[2-[[(4R)-1,9-dioxaspiro[5.5]undecan-4-yl]amino]ethylamino]-4-methyl-1H-pyrimidin-6-one (PubChem CID 136808425) has the molecular formula C16H26N4O3 and a molecular weight of 322.41 g/mol. Its IUPAC name is 2-[2-[[(4R)-1,9-dioxaspiro[5.5]undecan-4-yl]amino]ethylamino]-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-[2-[[(4R)-1,9-dioxaspiro[5.5]undecan-4-yl]amino]ethylamino]-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136808425 |
| Molecular Formula | C16H26N4O3 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 2-[2-[[(4R)-1,9-dioxaspiro[5.5]undecan-4-yl]amino]ethylamino]-4-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1cc(=O)[nH]c(NCCN[C@@H]2CCOC3(CCOCC3)C2)n1 |
| InChI | InChI=1S/C16H26N4O3/c1-12-10-14(21)20-15(19-12)18-6-5-17-13-2-7-23-16(11-13)3-8-22-9-4-16/h10,13,17H,2-9,11H2,1H3,(H2,18,19,20,21)/t13-/m1/s1 |
| InChIKey | DQDCIGPERRJPBC-CYBMUJFWSA-N |
| XLogP | 0.81 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|