C14H19N5O — CID 136808766
6-amino-2-[(1-methylpiperidin-3-yl)amino]-3H-quinazolin-4-one (PubChem CID 136808766) has the molecular formula C14H19N5O and a molecular weight of 273.34 g/mol. Its IUPAC name is 6-amino-2-[(1-methylpiperidin-3-yl)amino]-3H-quinazolin-4-one.
| Compound Name | 6-amino-2-[(1-methylpiperidin-3-yl)amino]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 136808766 |
| Molecular Formula | C14H19N5O |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 6-amino-2-[(1-methylpiperidin-3-yl)amino]-3H-quinazolin-4-one |
| SMILES | CN1CCCC(Nc2nc3ccc(N)cc3c(=O)[nH]2)C1 |
| InChI | InChI=1S/C14H19N5O/c1-19-6-2-3-10(8-19)16-14-17-12-5-4-9(15)7-11(12)13(20)18-14/h4-5,7,10H,2-3,6,8,15H2,1H3,(H2,16,17,18,20) |
| InChIKey | QFRVXFIIMCRWMB-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|