C11H11N3O3 — CID 136809586
6-amino-2-(oxetan-3-yloxy)-3H-quinazolin-4-one (PubChem CID 136809586) has the molecular formula C11H11N3O3 and a molecular weight of 233.23 g/mol. Its IUPAC name is 6-amino-2-(oxetan-3-yloxy)-3H-quinazolin-4-one.
| Compound Name | 6-amino-2-(oxetan-3-yloxy)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 136809586 |
| Molecular Formula | C11H11N3O3 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 6-amino-2-(oxetan-3-yloxy)-3H-quinazolin-4-one |
| SMILES | Nc1ccc2nc(OC3COC3)[nH]c(=O)c2c1 |
| InChI | InChI=1S/C11H11N3O3/c12-6-1-2-9-8(3-6)10(15)14-11(13-9)17-7-4-16-5-7/h1-3,7H,4-5,12H2,(H,13,14,15) |
| InChIKey | INJFHQDVCLNOKC-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|