C8H9N5O4 — CID 136809711
(6S)-2-amino-5-formyl-4-oxo-3,6,7,8-tetrahydropteridine-6-carboxylic acid (PubChem CID 136809711) has the molecular formula C8H9N5O4 and a molecular weight of 239.19 g/mol. Its IUPAC name is (6S)-2-amino-5-formyl-4-oxo-3,6,7,8-tetrahydropteridine-6-carboxylic acid.
| Compound Name | (6S)-2-amino-5-formyl-4-oxo-3,6,7,8-tetrahydropteridine-6-carboxylic acid |
|---|---|
| PubChem CID | 136809711 |
| Molecular Formula | C8H9N5O4 |
| Molecular Weight | 239.19 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | (6S)-2-amino-5-formyl-4-oxo-3,6,7,8-tetrahydropteridine-6-carboxylic acid |
| SMILES | Nc1nc2c(c(=O)[nH]1)N(C=O)[C@H](C(=O)O)CN2 |
| InChI | InChI=1S/C8H9N5O4/c9-8-11-5-4(6(15)12-8)13(2-14)3(1-10-5)7(16)17/h2-3H,1H2,(H,16,17)(H4,9,10,11,12,15)/t3-/m0/s1 |
| InChIKey | XAUVAYMHNAPWPN-VKHMYHEASA-N |
| XLogP | -1.81 |
| TPSA | 141.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.19 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|