About 2-chloro-4,6-dinitrophenol
2-chloro-4,6-dinitrophenol (PubChem CID 13681) has the molecular formula C6H3ClN2O5
and a molecular weight of 218.55 g/mol. Its IUPAC name is 2-chloro-4,6-dinitrophenol.
Molecular Properties
| Compound Name | 2-chloro-4,6-dinitrophenol |
| PubChem CID | 13681 |
| Molecular Formula | C6H3ClN2O5 |
| Molecular Weight | 218.55 g/mol |
| Exact Mass | 217.97 |
| IUPAC Name | 2-chloro-4,6-dinitrophenol |
| SMILES | O=[N+]([O-])c1cc(Cl)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C6H3ClN2O5/c7-4-1-3(8(11)12)2-5(6(4)10)9(13)14/h1-2,10H |
| InChIKey | PCBCIXWBAPIVDV-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.55 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4,6-dinitrophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4,6-dinitrophenol?
The IUPAC name of 2-chloro-4,6-dinitrophenol (CID 13681) is 2-chloro-4,6-dinitrophenol.
What is the SMILES notation for 2-chloro-4,6-dinitrophenol?
The canonical SMILES for 2-chloro-4,6-dinitrophenol is O=[N+]([O-])c1cc(Cl)c(O)c([N+](=O)[O-])c1.
What is the InChIKey of 2-chloro-4,6-dinitrophenol?
The InChIKey is PCBCIXWBAPIVDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3ClN2O5/c7-4-1-3(8(11)12)2-5(6(4)10)9(13)14/h1-2,10H.
What are the key properties of 2-chloro-4,6-dinitrophenol?
2-chloro-4,6-dinitrophenol has a molecular weight of 218.55 g/mol, XLogP of 1.86, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4,6-dinitrophenol is sourced from PubChem (CID 13681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).