About 3-fluoro-4-hydroxy-N,N-dimethylbenzenecarboximidamide
3-fluoro-4-hydroxy-N,N-dimethylbenzenecarboximidamide (PubChem CID 136810259) has the molecular formula C9H11FN2O
and a molecular weight of 182.20 g/mol. Its IUPAC name is 3-fluoro-4-hydroxy-N,N-dimethylbenzenecarboximidamide.
Molecular Properties
| Compound Name | 3-fluoro-4-hydroxy-N,N-dimethylbenzenecarboximidamide |
| PubChem CID | 136810259 |
| Molecular Formula | C9H11FN2O |
| Molecular Weight | 182.20 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 3-fluoro-4-hydroxy-N,N-dimethylbenzenecarboximidamide |
| SMILES | [H]/N=C(/c1ccc(O)c(F)c1)N(C)C |
| InChI | InChI=1S/C9H11FN2O/c1-12(2)9(11)6-3-4-8(13)7(10)5-6/h3-5,11,13H,1-2H3/b11-9- |
| InChIKey | CANBYZNMSJODPI-LUAWRHEFSA-N |
| XLogP | 1.42 |
| TPSA | 47.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.20 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-4-hydroxy-N,N-dimethylbenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-4-hydroxy-N,N-dimethylbenzenecarboximidamide?
The IUPAC name of 3-fluoro-4-hydroxy-N,N-dimethylbenzenecarboximidamide (CID 136810259) is 3-fluoro-4-hydroxy-N,N-dimethylbenzenecarboximidamide.
What is the SMILES notation for 3-fluoro-4-hydroxy-N,N-dimethylbenzenecarboximidamide?
The canonical SMILES for 3-fluoro-4-hydroxy-N,N-dimethylbenzenecarboximidamide is [H]/N=C(/c1ccc(O)c(F)c1)N(C)C.
What is the InChIKey of 3-fluoro-4-hydroxy-N,N-dimethylbenzenecarboximidamide?
The InChIKey is CANBYZNMSJODPI-LUAWRHEFSA-N. The full InChI is InChI=1S/C9H11FN2O/c1-12(2)9(11)6-3-4-8(13)7(10)5-6/h3-5,11,13H,1-2H3/b11-9-.
What are the key properties of 3-fluoro-4-hydroxy-N,N-dimethylbenzenecarboximidamide?
3-fluoro-4-hydroxy-N,N-dimethylbenzenecarboximidamide has a molecular weight of 182.20 g/mol, XLogP of 1.42, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-4-hydroxy-N,N-dimethylbenzenecarboximidamide is sourced from PubChem (CID 136810259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).