C18H22N8O3S — CID 136810464
(5R,6R,7S)-7-(1,3-dimethylpyrazol-4-yl)-5-methyl-N-(4-sulfamoylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 136810464) has the molecular formula C18H22N8O3S and a molecular weight of 430.49 g/mol. Its IUPAC name is (5R,6R,7S)-7-(1,3-dimethylpyrazol-4-yl)-5-methyl-N-(4-sulfamoylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | (5R,6R,7S)-7-(1,3-dimethylpyrazol-4-yl)-5-methyl-N-(4-sulfamoylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 136810464 |
| Molecular Formula | C18H22N8O3S |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | (5R,6R,7S)-7-(1,3-dimethylpyrazol-4-yl)-5-methyl-N-(4-sulfamoylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | Cc1nn(C)cc1[C@@H]1[C@H](C(=O)Nc2ccc(S(N)(=O)=O)cc2)[C@@H](C)Nc2ncnn21 |
| InChI | InChI=1S/C18H22N8O3S/c1-10-14(8-25(3)24-10)16-15(11(2)22-18-20-9-21-26(16)18)17(27)23-12-4-6-13(7-5-12)30(19,28)29/h4-9,11,15-16H,1-3H3,(H,23,27)(H2,19,28,29)(H,20,21,22)/t11-,15-,16-/m1/s1 |
| InChIKey | PMQMYTKXFOJWFH-HFBAOOFYSA-N |
| XLogP | 0.63 |
| TPSA | 149.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |