C29H29N3O3 — CID 1368109
2-[(2R)-3-[2-[(1S)-cyclohex-3-en-1-yl]benzimidazol-1-yl]-2-hydroxypropoxy]-N-phenylbenzamide (PubChem CID 1368109) has the molecular formula C29H29N3O3 and a molecular weight of 467.57 g/mol. Its IUPAC name is 2-[(2R)-3-[2-[(1S)-cyclohex-3-en-1-yl]benzimidazol-1-yl]-2-hydroxypropoxy]-N-phenylbenzamide.
| Compound Name | 2-[(2R)-3-[2-[(1S)-cyclohex-3-en-1-yl]benzimidazol-1-yl]-2-hydroxypropoxy]-N-phenylbenzamide |
|---|---|
| PubChem CID | 1368109 |
| Molecular Formula | C29H29N3O3 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 2-[(2R)-3-[2-[(1S)-cyclohex-3-en-1-yl]benzimidazol-1-yl]-2-hydroxypropoxy]-N-phenylbenzamide |
| SMILES | O=C(Nc1ccccc1)c1ccccc1OC[C@H](O)Cn1c([C@@H]2CC=CCC2)nc2ccccc21 |
| InChI | InChI=1S/C29H29N3O3/c33-23(19-32-26-17-9-8-16-25(26)31-28(32)21-11-3-1-4-12-21)20-35-27-18-10-7-15-24(27)29(34)30-22-13-5-2-6-14-22/h1-3,5-10,13-18,21,23,33H,4,11-12,19-20H2,(H,30,34)/t21-,23-/m1/s1 |
| InChIKey | IKFJTVTWHFEWTJ-FYYLOGMGSA-N |
| XLogP | 5.55 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|