C28H37N3OS — CID 136811166
1-[[(1R,4aR,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-5-imino-4-(4-methyl-1,3-thiazol-2-yl)-2H-pyrrol-3-ol (PubChem CID 136811166) has the molecular formula C28H37N3OS and a molecular weight of 463.69 g/mol. Its IUPAC name is 1-[[(1R,4aR,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-5-imino-4-(4-methyl-1,3-thiazol-2-yl)-2H-pyrrol-3-ol.
| Compound Name | 1-[[(1R,4aR,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-5-imino-4-(4-methyl-1,3-thiazol-2-yl)-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 136811166 |
| Molecular Formula | C28H37N3OS |
| Molecular Weight | 463.69 g/mol |
| Exact Mass | 463.27 |
| IUPAC Name | 1-[[(1R,4aR,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-5-imino-4-(4-methyl-1,3-thiazol-2-yl)-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1\C(c2nc(C)cs2)=C(O)CN1C[C@]1(C)CCC[C@@]2(C)c3ccc(C(C)C)cc3CC[C@@H]12 |
| InChI | InChI=1S/C28H37N3OS/c1-17(2)19-7-9-21-20(13-19)8-10-23-27(4,11-6-12-28(21,23)5)16-31-14-22(32)24(25(31)29)26-30-18(3)15-33-26/h7,9,13,15,17,23,29,32H,6,8,10-12,14,16H2,1-5H3/b29-25+/t23-,27-,28-/m0/s1 |
| InChIKey | DJRKITNSJBJXKM-TVWBDEQMSA-N |
| XLogP | 6.85 |
| TPSA | 60.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.69 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|