C10H15N3OS — CID 136811603
4-ethyl-N-[(5-methyl-1,3-oxazol-2-yl)methyl]-1,3-thiazolidin-2-imine (PubChem CID 136811603) has the molecular formula C10H15N3OS and a molecular weight of 225.32 g/mol. Its IUPAC name is 4-ethyl-N-[(5-methyl-1,3-oxazol-2-yl)methyl]-1,3-thiazolidin-2-imine.
| Compound Name | 4-ethyl-N-[(5-methyl-1,3-oxazol-2-yl)methyl]-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 136811603 |
| Molecular Formula | C10H15N3OS |
| Molecular Weight | 225.32 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 4-ethyl-N-[(5-methyl-1,3-oxazol-2-yl)methyl]-1,3-thiazolidin-2-imine |
| SMILES | CCC1CS/C(=N\Cc2ncc(C)o2)N1 |
| InChI | InChI=1S/C10H15N3OS/c1-3-8-6-15-10(13-8)12-5-9-11-4-7(2)14-9/h4,8H,3,5-6H2,1-2H3,(H,12,13) |
| InChIKey | ZKRHNZIMILEMGW-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|