C31H37NO — CID 136811978
3,6-ditert-butyl-1-(3-tert-butylisoquinolin-1-yl)naphthalen-2-ol (PubChem CID 136811978) has the molecular formula C31H37NO and a molecular weight of 439.64 g/mol. Its IUPAC name is 3,6-ditert-butyl-1-(3-tert-butylisoquinolin-1-yl)naphthalen-2-ol.
| Compound Name | 3,6-ditert-butyl-1-(3-tert-butylisoquinolin-1-yl)naphthalen-2-ol |
|---|---|
| PubChem CID | 136811978 |
| Molecular Formula | C31H37NO |
| Molecular Weight | 439.64 g/mol |
| Exact Mass | 439.29 |
| IUPAC Name | 3,6-ditert-butyl-1-(3-tert-butylisoquinolin-1-yl)naphthalen-2-ol |
| SMILES | CC(C)(C)c1ccc2c(-c3nc(C(C)(C)C)cc4ccccc34)c(O)c(C(C)(C)C)cc2c1 |
| InChI | InChI=1S/C31H37NO/c1-29(2,3)21-14-15-22-20(16-21)17-24(30(4,5)6)28(33)26(22)27-23-13-11-10-12-19(23)18-25(32-27)31(7,8)9/h10-18,33H,1-9H3 |
| InChIKey | PUQOCPMHCCYUFS-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.64 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |