C13H8F5NO3 — CID 136812166
2-(cyclopropyliminomethyl)-3-hydroxy-3-(2,3,4,5,6-pentafluorophenyl)prop-2-enoic acid (PubChem CID 136812166) has the molecular formula C13H8F5NO3 and a molecular weight of 321.20 g/mol. Its IUPAC name is 2-(cyclopropyliminomethyl)-3-hydroxy-3-(2,3,4,5,6-pentafluorophenyl)prop-2-enoic acid.
| Compound Name | 2-(cyclopropyliminomethyl)-3-hydroxy-3-(2,3,4,5,6-pentafluorophenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 136812166 |
| Molecular Formula | C13H8F5NO3 |
| Molecular Weight | 321.20 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 2-(cyclopropyliminomethyl)-3-hydroxy-3-(2,3,4,5,6-pentafluorophenyl)prop-2-enoic acid |
| SMILES | O=C(O)C(/C=N/C1CC1)=C(O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H8F5NO3/c14-7-6(8(15)10(17)11(18)9(7)16)12(20)5(13(21)22)3-19-4-1-2-4/h3-4,20H,1-2H2,(H,21,22)/b12-5?,19-3+ |
| InChIKey | ITIRWCDCAVFWMB-ZAZVZJKCSA-N |
| XLogP | 2.97 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.20 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|